C25H35F2N5O3Si — CID 161353980
1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-[3-(dimethylamino)propyl]urea (PubChem CID 161353980) has the molecular formula C25H35F2N5O3Si and a molecular weight of 519.67 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-[3-(dimethylamino)propyl]urea.
| Compound Name | 1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-[3-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 161353980 |
| Molecular Formula | C25H35F2N5O3Si |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-[3-(dimethylamino)propyl]urea |
| SMILES | CN(C)CCCNC(=O)Nc1cc(F)c(Oc2ccnc3c2ccn3COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C25H35F2N5O3Si/c1-31(2)11-6-9-29-25(33)30-18-15-20(26)23(21(27)16-18)35-22-7-10-28-24-19(22)8-12-32(24)17-34-13-14-36(3,4)5/h7-8,10,12,15-16H,6,9,11,13-14,17H2,1-5H3,(H2,29,30,33) |
| InChIKey | VOHDZEAULOCNDX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|