C19H20BrF2N5O2 — CID 137362562
1-[4-[(3-bromo-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[3-(dimethylamino)propyl]urea (PubChem CID 137362562) has the molecular formula C19H20BrF2N5O2 and a molecular weight of 468.30 g/mol. Its IUPAC name is 1-[4-[(3-bromo-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[3-(dimethylamino)propyl]urea.
| Compound Name | 1-[4-[(3-bromo-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[3-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 137362562 |
| Molecular Formula | C19H20BrF2N5O2 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 1-[4-[(3-bromo-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[3-(dimethylamino)propyl]urea |
| SMILES | CN(C)CCCNC(=O)Nc1cc(F)c(Oc2ccnc3[nH]cc(Br)c23)c(F)c1 |
| InChI | InChI=1S/C19H20BrF2N5O2/c1-27(2)7-3-5-24-19(28)26-11-8-13(21)17(14(22)9-11)29-15-4-6-23-18-16(15)12(20)10-25-18/h4,6,8-10H,3,5,7H2,1-2H3,(H,23,25)(H2,24,26,28) |
| InChIKey | QBSLGOQRYRYOJG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|