C18H15ClF2N6O3 — CID 142494809
1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[(2Z)-2-hydroxyimino-3-iminobutyl]urea (PubChem CID 142494809) has the molecular formula C18H15ClF2N6O3 and a molecular weight of 436.81 g/mol. Its IUPAC name is 1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[(2Z)-2-hydroxyimino-3-iminobutyl]urea.
| Compound Name | 1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[(2Z)-2-hydroxyimino-3-iminobutyl]urea |
|---|---|
| PubChem CID | 142494809 |
| Molecular Formula | C18H15ClF2N6O3 |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-[(2Z)-2-hydroxyimino-3-iminobutyl]urea |
| SMILES | [H]/N=C(C)/C(CNC(=O)Nc1cc(F)c(Oc2ccnc3[nH]cc(Cl)c23)c(F)c1)=N\O |
| InChI | InChI=1S/C18H15ClF2N6O3/c1-8(22)13(27-29)7-25-18(28)26-9-4-11(20)16(12(21)5-9)30-14-2-3-23-17-15(14)10(19)6-24-17/h2-6,22,29H,7H2,1H3,(H,23,24)(H2,25,26,28)/b22-8+,27-13- |
| InChIKey | WPXOMQXOVQEEHQ-CKTPMIBCSA-N |
| XLogP | 4.28 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|