C22H22F2N6O3 — CID 137362281
1-[4-[(3-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 137362281) has the molecular formula C22H22F2N6O3 and a molecular weight of 456.45 g/mol. Its IUPAC name is 1-[4-[(3-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[4-[(3-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 137362281 |
| Molecular Formula | C22H22F2N6O3 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-[4-[(3-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]-3,5-difluorophenyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | N#Cc1c[nH]c2nccc(Oc3c(F)cc(NC(=O)NCCCN4CCOCC4)cc3F)c12 |
| InChI | InChI=1S/C22H22F2N6O3/c23-16-10-15(29-22(31)27-3-1-5-30-6-8-32-9-7-30)11-17(24)20(16)33-18-2-4-26-21-19(18)14(12-25)13-28-21/h2,4,10-11,13H,1,3,5-9H2,(H,26,28)(H2,27,29,31) |
| InChIKey | ZFWLBVMSMJLTQL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|