C23H26F3N5O3 — CID 137363779
1-[3-methyl-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 137363779) has the molecular formula C23H26F3N5O3 and a molecular weight of 477.49 g/mol. Its IUPAC name is 1-[3-methyl-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[3-methyl-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 137363779 |
| Molecular Formula | C23H26F3N5O3 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-[3-methyl-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | Cc1cc(NC(=O)NCCCN2CCOCC2)ccc1Oc1ccnc2[nH]cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C23H26F3N5O3/c1-15-13-16(30-22(32)28-6-2-8-31-9-11-33-12-10-31)3-4-18(15)34-19-5-7-27-21-20(19)17(14-29-21)23(24,25)26/h3-5,7,13-14H,2,6,8-12H2,1H3,(H,27,29)(H2,28,30,32) |
| InChIKey | PXYFSGFGVJGQGS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|