C24H25ClF3N3O3 — CID 158224854
1-[3-chloro-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-6-morpholin-4-ylhexan-2-one (PubChem CID 158224854) has the molecular formula C24H25ClF3N3O3 and a molecular weight of 495.93 g/mol. Its IUPAC name is 1-[3-chloro-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-6-morpholin-4-ylhexan-2-one.
| Compound Name | 1-[3-chloro-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-6-morpholin-4-ylhexan-2-one |
|---|---|
| PubChem CID | 158224854 |
| Molecular Formula | C24H25ClF3N3O3 |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 1-[3-chloro-4-[[3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-6-morpholin-4-ylhexan-2-one |
| SMILES | O=C(CCCCN1CCOCC1)Cc1ccc(Oc2ccnc3[nH]cc(C(F)(F)F)c23)c(Cl)c1 |
| InChI | InChI=1S/C24H25ClF3N3O3/c25-19-14-16(13-17(32)3-1-2-8-31-9-11-33-12-10-31)4-5-20(19)34-21-6-7-29-23-22(21)18(15-30-23)24(26,27)28/h4-7,14-15H,1-3,8-13H2,(H,29,30) |
| InChIKey | GDRDETIJBZQZCM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|