C25H35N3O4Si — CID 159521192
tert-butyl N-[[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]methyl]carbamate (PubChem CID 159521192) has the molecular formula C25H35N3O4Si and a molecular weight of 469.66 g/mol. Its IUPAC name is tert-butyl N-[[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 159521192 |
| Molecular Formula | C25H35N3O4Si |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | tert-butyl N-[[4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(Oc2ccnc3c2ccn3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C25H35N3O4Si/c1-25(2,3)32-24(29)27-17-19-7-9-20(10-8-19)31-22-11-13-26-23-21(22)12-14-28(23)18-30-15-16-33(4,5)6/h7-14H,15-18H2,1-6H3,(H,27,29) |
| InChIKey | MBUXORVOTHLDEJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|