C33H47IN4O5Si — CID 140891559
tert-butyl N-[(2S)-1-(cyclohexylamino)-3-[4-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-1-oxopropan-2-yl]carbamate (PubChem CID 140891559) has the molecular formula C33H47IN4O5Si and a molecular weight of 734.75 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(cyclohexylamino)-3-[4-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(cyclohexylamino)-3-[4-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 140891559 |
| Molecular Formula | C33H47IN4O5Si |
| Molecular Weight | 734.75 g/mol |
| Exact Mass | 734.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-(cyclohexylamino)-3-[4-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(Oc2ccnc3c2c(I)cn3COCC[Si](C)(C)C)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C33H47IN4O5Si/c1-33(2,3)43-32(40)37-27(31(39)36-24-10-8-7-9-11-24)20-23-12-14-25(15-13-23)42-28-16-17-35-30-29(28)26(34)21-38(30)22-41-18-19-44(4,5)6/h12-17,21,24,27H,7-11,18-20,22H2,1-6H3,(H,36,39)(H,37,40)/t27-/m0/s1 |
| InChIKey | PKIRBHRZPNOMIW-MHZLTWQESA-N |
| XLogP | 7.63 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.75 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|