C24H38IN3O4Si — CID 177243004
tert-butyl (3R,5S)-3-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-5-methylpiperidine-1-carboxylate (PubChem CID 177243004) has the molecular formula C24H38IN3O4Si and a molecular weight of 587.58 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-5-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-3-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-5-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177243004 |
| Molecular Formula | C24H38IN3O4Si |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | tert-butyl (3R,5S)-3-[3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-5-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](Oc2ccnc3c2c(I)cn3COCC[Si](C)(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H38IN3O4Si/c1-17-12-18(14-27(13-17)23(29)32-24(2,3)4)31-20-8-9-26-22-21(20)19(25)15-28(22)16-30-10-11-33(5,6)7/h8-9,15,17-18H,10-14,16H2,1-7H3/t17-,18+/m0/s1 |
| InChIKey | PUTDJGCXGRMLNO-ZWKOTPCHSA-N |
| XLogP | 5.98 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|