C30H44N6O3Si — CID 165156421
tert-butyl 9-[3-pyridazin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,9-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 165156421) has the molecular formula C30H44N6O3Si and a molecular weight of 564.81 g/mol. Its IUPAC name is tert-butyl 9-[3-pyridazin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,9-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 9-[3-pyridazin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,9-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 165156421 |
| Molecular Formula | C30H44N6O3Si |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | tert-butyl 9-[3-pyridazin-4-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,9-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN(c3ccnc4c3c(-c3ccnnc3)cn4COCC[Si](C)(C)C)C2)C1 |
| InChI | InChI=1S/C30H44N6O3Si/c1-29(2,3)39-28(37)35-15-11-30(21-35)10-7-14-34(20-30)25-9-12-31-27-26(25)24(23-8-13-32-33-18-23)19-36(27)22-38-16-17-40(4,5)6/h8-9,12-13,18-19H,7,10-11,14-17,20-22H2,1-6H3 |
| InChIKey | WGVITURRJVIVNX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|