C28H42N6O3Si — CID 165156458
tert-butyl N-methyl-N-[(3S)-1-[3-pyrazin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate (PubChem CID 165156458) has the molecular formula C28H42N6O3Si and a molecular weight of 538.77 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(3S)-1-[3-pyrazin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(3S)-1-[3-pyrazin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 165156458 |
| Molecular Formula | C28H42N6O3Si |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | tert-butyl N-methyl-N-[(3S)-1-[3-pyrazin-2-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1CCCN(c2ccnc3c2c(-c2cnccn2)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C28H42N6O3Si/c1-28(2,3)37-27(35)32(4)21-9-8-14-33(18-21)24-10-11-31-26-25(24)22(23-17-29-12-13-30-23)19-34(26)20-36-15-16-38(5,6)7/h10-13,17,19,21H,8-9,14-16,18,20H2,1-7H3/t21-/m0/s1 |
| InChIKey | JTSKLWDBUMZPBS-NRFANRHFSA-N |
| XLogP | 5.64 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|