C25H36N6OSi — CID 165156384
2-[[4-[(5R)-2,6-diazaspiro[4.5]decan-2-yl]-3-pyrimidin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 165156384) has the molecular formula C25H36N6OSi and a molecular weight of 464.69 g/mol. Its IUPAC name is 2-[[4-[(5R)-2,6-diazaspiro[4.5]decan-2-yl]-3-pyrimidin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(5R)-2,6-diazaspiro[4.5]decan-2-yl]-3-pyrimidin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 165156384 |
| Molecular Formula | C25H36N6OSi |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2-[[4-[(5R)-2,6-diazaspiro[4.5]decan-2-yl]-3-pyrimidin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccncn2)c2c(N3CC[C@]4(CCCCN4)C3)ccnc21 |
| InChI | InChI=1S/C25H36N6OSi/c1-33(2,3)15-14-32-19-31-16-20(21-6-11-26-18-28-21)23-22(7-12-27-24(23)31)30-13-9-25(17-30)8-4-5-10-29-25/h6-7,11-12,16,18,29H,4-5,8-10,13-15,17,19H2,1-3H3/t25-/m1/s1 |
| InChIKey | DINPLKFTXGPYIU-RUZDIDTESA-N |
| XLogP | 4.53 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|