C19H28N6OSSi — CID 58395794
N,N-dimethyl-5-(2-methylsulfanylpyrimidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 58395794) has the molecular formula C19H28N6OSSi and a molecular weight of 416.63 g/mol. Its IUPAC name is N,N-dimethyl-5-(2-methylsulfanylpyrimidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N,N-dimethyl-5-(2-methylsulfanylpyrimidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 58395794 |
| Molecular Formula | C19H28N6OSSi |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N,N-dimethyl-5-(2-methylsulfanylpyrimidin-4-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CSc1nccc(-c2cn(COCC[Si](C)(C)C)c3ncnc(N(C)C)c23)n1 |
| InChI | InChI=1S/C19H28N6OSSi/c1-24(2)17-16-14(15-7-8-20-19(23-15)27-3)11-25(18(16)22-12-21-17)13-26-9-10-28(4,5)6/h7-8,11-12H,9-10,13H2,1-6H3 |
| InChIKey | JFRUTBWMXJFRSS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|