C21H23ClN4O2Si — CID 172562690
6-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]quinolin-3-ol (PubChem CID 172562690) has the molecular formula C21H23ClN4O2Si and a molecular weight of 426.98 g/mol. Its IUPAC name is 6-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]quinolin-3-ol.
| Compound Name | 6-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]quinolin-3-ol |
|---|---|
| PubChem CID | 172562690 |
| Molecular Formula | C21H23ClN4O2Si |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 6-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]quinolin-3-ol |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccc3ncc(O)cc3c2)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C21H23ClN4O2Si/c1-29(2,3)7-6-28-13-26-11-17(19-20(22)24-12-25-21(19)26)14-4-5-18-15(8-14)9-16(27)10-23-18/h4-5,8-12,27H,6-7,13H2,1-3H3 |
| InChIKey | GUSCHTRASHXWAM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|