C24H34ClN5O2Si — CID 175867753
5-[[5-(3-chlorophenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-4-methylpentanamide (PubChem CID 175867753) has the molecular formula C24H34ClN5O2Si and a molecular weight of 488.11 g/mol. Its IUPAC name is 5-[[5-(3-chlorophenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-4-methylpentanamide.
| Compound Name | 5-[[5-(3-chlorophenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 175867753 |
| Molecular Formula | C24H34ClN5O2Si |
| Molecular Weight | 488.11 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 5-[[5-(3-chlorophenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-4-methylpentanamide |
| SMILES | CC(CCC(N)=O)CNc1ncnc2c1c(-c1cccc(Cl)c1)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H34ClN5O2Si/c1-17(8-9-21(26)31)13-27-23-22-20(18-6-5-7-19(25)12-18)14-30(24(22)29-15-28-23)16-32-10-11-33(2,3)4/h5-7,12,14-15,17H,8-11,13,16H2,1-4H3,(H2,26,31)(H,27,28,29) |
| InChIKey | MCXSXVBPRPDTJI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.11 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|