C20H23N5O3 — CID 11589023
N-cyclopropyl-2-[[7-(2-hydroxyethoxymethyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide (PubChem CID 11589023) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-cyclopropyl-2-[[7-(2-hydroxyethoxymethyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide.
| Compound Name | N-cyclopropyl-2-[[7-(2-hydroxyethoxymethyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 11589023 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-cyclopropyl-2-[[7-(2-hydroxyethoxymethyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide |
| SMILES | O=C(CNc1ncnc2c1c(-c1ccccc1)cn2COCCO)NC1CC1 |
| InChI | InChI=1S/C20H23N5O3/c26-8-9-28-13-25-11-16(14-4-2-1-3-5-14)18-19(22-12-23-20(18)25)21-10-17(27)24-15-6-7-15/h1-5,11-12,15,26H,6-10,13H2,(H,24,27)(H,21,22,23) |
| InChIKey | AOFQNKSGOISTOW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|