C19H19N3OS2 — CID 1154282
N-cyclopentyl-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide (PubChem CID 1154282) has the molecular formula C19H19N3OS2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-cyclopentyl-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-cyclopentyl-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1154282 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-cyclopentyl-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
| SMILES | O=C(CSc1ncnc2scc(-c3ccccc3)c12)NC1CCCC1 |
| InChI | InChI=1S/C19H19N3OS2/c23-16(22-14-8-4-5-9-14)11-25-19-17-15(13-6-2-1-3-7-13)10-24-18(17)20-12-21-19/h1-3,6-7,10,12,14H,4-5,8-9,11H2,(H,22,23) |
| InChIKey | GFQLNGRTBFIRPQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |