C20H14N4O3S2 — CID 35686306
N-(2-nitrophenyl)-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide (PubChem CID 35686306) has the molecular formula C20H14N4O3S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-(2-nitrophenyl)-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-(2-nitrophenyl)-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 35686306 |
| Molecular Formula | C20H14N4O3S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-(2-nitrophenyl)-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
| SMILES | O=C(CSc1ncnc2scc(-c3ccccc3)c12)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14N4O3S2/c25-17(23-15-8-4-5-9-16(15)24(26)27)11-29-20-18-14(13-6-2-1-3-7-13)10-28-19(18)21-12-22-20/h1-10,12H,11H2,(H,23,25) |
| InChIKey | MTRJPHXFZKLICO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|