C22H19N3OS2 — CID 2946517
N-[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenyl]butanamide (PubChem CID 2946517) has the molecular formula C22H19N3OS2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenyl]butanamide.
| Compound Name | N-[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenyl]butanamide |
|---|---|
| PubChem CID | 2946517 |
| Molecular Formula | C22H19N3OS2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccccc1Sc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C22H19N3OS2/c1-2-8-19(26)25-17-11-6-7-12-18(17)28-22-20-16(15-9-4-3-5-10-15)13-27-21(20)23-14-24-22/h3-7,9-14H,2,8H2,1H3,(H,25,26) |
| InChIKey | RPQFHSOTKCWCCP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |