C16H14N2O2S2 — CID 725222
ethyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate (PubChem CID 725222) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is ethyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate.
| Compound Name | ethyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 725222 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | ethyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C16H14N2O2S2/c1-2-20-13(19)9-22-16-14-12(11-6-4-3-5-7-11)8-21-15(14)17-10-18-16/h3-8,10H,2,9H2,1H3 |
| InChIKey | NLBUXXCPNGXUPA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |