C33H38N8O3Si — CID 90103036
2-[(1S)-1-[[5-(3-amino-5-hydroxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 90103036) has the molecular formula C33H38N8O3Si and a molecular weight of 622.81 g/mol. Its IUPAC name is 2-[(1S)-1-[[5-(3-amino-5-hydroxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[(1S)-1-[[5-(3-amino-5-hydroxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 90103036 |
| Molecular Formula | C33H38N8O3Si |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 2-[(1S)-1-[[5-(3-amino-5-hydroxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ccn2nc([C@H](C)Nc3ncnc4c3c(-c3cc(N)cc(O)c3)cn4COCC[Si](C)(C)C)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C33H38N8O3Si/c1-21-11-12-40-29(21)33(43)41(25-9-7-6-8-10-25)31(38-40)22(2)37-30-28-27(23-15-24(34)17-26(42)16-23)18-39(32(28)36-19-35-30)20-44-13-14-45(3,4)5/h6-12,15-19,22,42H,13-14,20,34H2,1-5H3,(H,35,36,37)/t22-/m0/s1 |
| InChIKey | YYSCYGZBYXTNMI-QFIPXVFZSA-N |
| XLogP | 5.98 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|