C27H32BrN7O2Si — CID 123446879
2-[1-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 123446879) has the molecular formula C27H32BrN7O2Si and a molecular weight of 594.59 g/mol. Its IUPAC name is 2-[1-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[1-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 123446879 |
| Molecular Formula | C27H32BrN7O2Si |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 2-[1-[[5-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ccn2nc(C(C)Nc3ncnc4c3c(Br)cn4COCC[Si](C)(C)C)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C27H32BrN7O2Si/c1-18-11-12-34-23(18)27(36)35(20-9-7-6-8-10-20)25(32-34)19(2)31-24-22-21(28)15-33(26(22)30-16-29-24)17-37-13-14-38(3,4)5/h6-12,15-16,19H,13-14,17H2,1-5H3,(H,29,30,31) |
| InChIKey | PSDVZZTZNZMBFJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|