C31H36N8O3Si — CID 131736210
5-methyl-2-[(1S)-1-[[5-(2-methyl-1,3-oxazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 131736210) has the molecular formula C31H36N8O3Si and a molecular weight of 596.77 g/mol. Its IUPAC name is 5-methyl-2-[(1S)-1-[[5-(2-methyl-1,3-oxazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 5-methyl-2-[(1S)-1-[[5-(2-methyl-1,3-oxazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 131736210 |
| Molecular Formula | C31H36N8O3Si |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 5-methyl-2-[(1S)-1-[[5-(2-methyl-1,3-oxazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ncc(-c2cn(COCC[Si](C)(C)C)c3ncnc(N[C@@H](C)c4nn5ccc(C)c5c(=O)n4-c4ccccc4)c23)o1 |
| InChI | InChI=1S/C31H36N8O3Si/c1-20-12-13-38-27(20)31(40)39(23-10-8-7-9-11-23)29(36-38)21(2)35-28-26-24(25-16-32-22(3)42-25)17-37(30(26)34-18-33-28)19-41-14-15-43(4,5)6/h7-13,16-18,21H,14-15,19H2,1-6H3,(H,33,34,35)/t21-/m0/s1 |
| InChIKey | SLGQRBOXGOYQOJ-NRFANRHFSA-N |
| XLogP | 5.99 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|