C20H26N2OSSi — CID 146169588
trimethyl-[2-[(4-methylsulfanyl-3-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane (PubChem CID 146169588) has the molecular formula C20H26N2OSSi and a molecular weight of 370.59 g/mol. Its IUPAC name is trimethyl-[2-[(4-methylsulfanyl-3-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(4-methylsulfanyl-3-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 146169588 |
| Molecular Formula | C20H26N2OSSi |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | trimethyl-[2-[(4-methylsulfanyl-3-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl]silane |
| SMILES | CSc1ccnc2c1c(-c1ccccc1)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H26N2OSSi/c1-24-18-10-11-21-20-19(18)17(16-8-6-5-7-9-16)14-22(20)15-23-12-13-25(2,3)4/h5-11,14H,12-13,15H2,1-4H3 |
| InChIKey | ZRGRDVBBJDOXLH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|