C20H25FN2O3Si — CID 137199432
4-fluoro-2-[3-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]phenol (PubChem CID 137199432) has the molecular formula C20H25FN2O3Si and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-fluoro-2-[3-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]phenol.
| Compound Name | 4-fluoro-2-[3-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]phenol |
|---|---|
| PubChem CID | 137199432 |
| Molecular Formula | C20H25FN2O3Si |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-fluoro-2-[3-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]phenol |
| SMILES | C[Si](C)(C)CCOCn1cc(CO)c2c(-c3cc(F)ccc3O)ccnc21 |
| InChI | InChI=1S/C20H25FN2O3Si/c1-27(2,3)9-8-26-13-23-11-14(12-24)19-16(6-7-22-20(19)23)17-10-15(21)4-5-18(17)25/h4-7,10-11,24-25H,8-9,12-13H2,1-3H3 |
| InChIKey | QXXSVECHZSGCML-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|