C22H26F2N4O2Si — CID 142518647
3-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]propanenitrile (PubChem CID 142518647) has the molecular formula C22H26F2N4O2Si and a molecular weight of 444.56 g/mol. Its IUPAC name is 3-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]propanenitrile.
| Compound Name | 3-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]propanenitrile |
|---|---|
| PubChem CID | 142518647 |
| Molecular Formula | C22H26F2N4O2Si |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]propanenitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(CCC#N)c2c(Oc3c(F)cc(N)cc3F)ccnc21 |
| InChI | InChI=1S/C22H26F2N4O2Si/c1-31(2,3)10-9-29-14-28-13-15(5-4-7-25)20-19(6-8-27-22(20)28)30-21-17(23)11-16(26)12-18(21)24/h6,8,11-13H,4-5,9-10,14,26H2,1-3H3 |
| InChIKey | RTQRQFWMJJQJHA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|