C14H9F2I2N3O — CID 137435319
3,5-difluoro-4-[3-iodo-1-(iodomethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline (PubChem CID 137435319) has the molecular formula C14H9F2I2N3O and a molecular weight of 527.05 g/mol. Its IUPAC name is 3,5-difluoro-4-[3-iodo-1-(iodomethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline.
| Compound Name | 3,5-difluoro-4-[3-iodo-1-(iodomethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 137435319 |
| Molecular Formula | C14H9F2I2N3O |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.88 |
| IUPAC Name | 3,5-difluoro-4-[3-iodo-1-(iodomethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyaniline |
| SMILES | Nc1cc(F)c(Oc2ccnc3c2c(I)cn3CI)c(F)c1 |
| InChI | InChI=1S/C14H9F2I2N3O/c15-8-3-7(19)4-9(16)13(8)22-11-1-2-20-14-12(11)10(18)5-21(14)6-17/h1-5H,6,19H2 |
| InChIKey | VNKSENYYIJKGPJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|