C26H23F3N4O4Si — CID 142518616
5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-fluorobenzonitrile (PubChem CID 142518616) has the molecular formula C26H23F3N4O4Si and a molecular weight of 540.57 g/mol. Its IUPAC name is 5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 142518616 |
| Molecular Formula | C26H23F3N4O4Si |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-fluorobenzonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccc(F)c(C#N)c2)c2c(Oc3c(F)cc([N+](=O)[O-])cc3F)ccnc21 |
| InChI | InChI=1S/C26H23F3N4O4Si/c1-38(2,3)9-8-36-15-32-14-19(16-4-5-20(27)17(10-16)13-30)24-23(6-7-31-26(24)32)37-25-21(28)11-18(33(34)35)12-22(25)29/h4-7,10-12,14H,8-9,15H2,1-3H3 |
| InChIKey | JNKZYHMQNRVKNH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 103.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|