C27H26F2N4O5Si — CID 142518646
5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-methoxybenzonitrile (PubChem CID 142518646) has the molecular formula C27H26F2N4O5Si and a molecular weight of 552.61 g/mol. Its IUPAC name is 5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-methoxybenzonitrile.
| Compound Name | 5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 142518646 |
| Molecular Formula | C27H26F2N4O5Si |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 5-[4-(2,6-difluoro-4-nitrophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(-c2cn(COCC[Si](C)(C)C)c3nccc(Oc4c(F)cc([N+](=O)[O-])cc4F)c23)cc1C#N |
| InChI | InChI=1S/C27H26F2N4O5Si/c1-36-23-6-5-17(11-18(23)14-30)20-15-32(16-37-9-10-39(2,3)4)27-25(20)24(7-8-31-27)38-26-21(28)12-19(33(34)35)13-22(26)29/h5-8,11-13,15H,9-10,16H2,1-4H3 |
| InChIKey | JLRVIBGSHFIMMU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 112.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|