C27H28F2N4O3Si — CID 142518592
2-[4-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]phenoxy]acetonitrile (PubChem CID 142518592) has the molecular formula C27H28F2N4O3Si and a molecular weight of 522.63 g/mol. Its IUPAC name is 2-[4-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 142518592 |
| Molecular Formula | C27H28F2N4O3Si |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-[4-[4-(4-amino-2,6-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]phenoxy]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccc(OCC#N)cc2)c2c(Oc3c(F)cc(N)cc3F)ccnc21 |
| InChI | InChI=1S/C27H28F2N4O3Si/c1-37(2,3)13-12-34-17-33-16-21(18-4-6-20(7-5-18)35-11-9-30)25-24(8-10-32-27(25)33)36-26-22(28)14-19(31)15-23(26)29/h4-8,10,14-16H,11-13,17,31H2,1-3H3 |
| InChIKey | KXABQSITZPJVLN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|