C33H37F2N5O5Si — CID 175773041
1-[4-[3-(4-cyano-3-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(1R)-1-(oxetan-3-yl)ethyl]urea (PubChem CID 175773041) has the molecular formula C33H37F2N5O5Si and a molecular weight of 649.77 g/mol. Its IUPAC name is 1-[4-[3-(4-cyano-3-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(1R)-1-(oxetan-3-yl)ethyl]urea.
| Compound Name | 1-[4-[3-(4-cyano-3-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(1R)-1-(oxetan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 175773041 |
| Molecular Formula | C33H37F2N5O5Si |
| Molecular Weight | 649.77 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | 1-[4-[3-(4-cyano-3-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-3-[(1R)-1-(oxetan-3-yl)ethyl]urea |
| SMILES | COc1cc(-c2cn(COCC[Si](C)(C)C)c3nccc(Oc4c(F)cc(NC(=O)N[C@H](C)C5COC5)cc4F)c23)ccc1C#N |
| InChI | InChI=1S/C33H37F2N5O5Si/c1-20(23-17-44-18-23)38-33(41)39-24-13-26(34)31(27(35)14-24)45-28-8-9-37-32-30(28)25(16-40(32)19-43-10-11-46(3,4)5)21-6-7-22(15-36)29(12-21)42-2/h6-9,12-14,16,20,23H,10-11,17-19H2,1-5H3,(H2,38,39,41)/t20-/m1/s1 |
| InChIKey | SHLUNMPQCHHVFV-HXUWFJFHSA-N |
| XLogP | 7.12 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.77 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|