C27H27BrF2N2O4Si — CID 167614825
phenyl 2-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]acetate (PubChem CID 167614825) has the molecular formula C27H27BrF2N2O4Si and a molecular weight of 589.51 g/mol. Its IUPAC name is phenyl 2-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]acetate.
| Compound Name | phenyl 2-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]acetate |
|---|---|
| PubChem CID | 167614825 |
| Molecular Formula | C27H27BrF2N2O4Si |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | phenyl 2-[4-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]acetate |
| SMILES | C[Si](C)(C)CCOCn1cc(Br)c2c(Oc3c(F)cc(CC(=O)Oc4ccccc4)cc3F)ccnc21 |
| InChI | InChI=1S/C27H27BrF2N2O4Si/c1-37(2,3)12-11-34-17-32-16-20(28)25-23(9-10-31-27(25)32)36-26-21(29)13-18(14-22(26)30)15-24(33)35-19-7-5-4-6-8-19/h4-10,13-14,16H,11-12,15,17H2,1-3H3 |
| InChIKey | LPABJOSSQIGCPX-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|