C31H41ClF2N2O4SSi — CID 167671647
tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-7-sulfanylideneoctanoate (PubChem CID 167671647) has the molecular formula C31H41ClF2N2O4SSi and a molecular weight of 639.28 g/mol. Its IUPAC name is tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-7-sulfanylideneoctanoate.
| Compound Name | tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-7-sulfanylideneoctanoate |
|---|---|
| PubChem CID | 167671647 |
| Molecular Formula | C31H41ClF2N2O4SSi |
| Molecular Weight | 639.28 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | tert-butyl 8-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-7-sulfanylideneoctanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCC(=S)Cc1cc(F)c(Oc2ccnc3c2c(Cl)cn3COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C31H41ClF2N2O4SSi/c1-31(2,3)40-27(37)11-9-7-8-10-22(41)16-21-17-24(33)29(25(34)18-21)39-26-12-13-35-30-28(26)23(32)19-36(30)20-38-14-15-42(4,5)6/h12-13,17-19H,7-11,14-16,20H2,1-6H3 |
| InChIKey | UEZRSHRMIUGIEH-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.28 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|