C34H43F5N2O4SSi — CID 163836720
1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[4-(hydroxymethyl)oxan-4-yl]butane-2-thione (PubChem CID 163836720) has the molecular formula C34H43F5N2O4SSi and a molecular weight of 698.87 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[4-(hydroxymethyl)oxan-4-yl]butane-2-thione.
| Compound Name | 1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[4-(hydroxymethyl)oxan-4-yl]butane-2-thione |
|---|---|
| PubChem CID | 163836720 |
| Molecular Formula | C34H43F5N2O4SSi |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.26 |
| IUPAC Name | 1-[3,5-difluoro-4-[3-[1-(trifluoromethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-4-[4-(hydroxymethyl)oxan-4-yl]butane-2-thione |
| SMILES | C[Si](C)(C)CCOCn1cc(C2(C(F)(F)F)CCC2)c2c(Oc3c(F)cc(CC(=S)CCC4(CO)CCOCC4)cc3F)ccnc21 |
| InChI | InChI=1S/C34H43F5N2O4SSi/c1-47(2,3)16-15-44-22-41-20-25(33(7-4-8-33)34(37,38)39)29-28(6-12-40-31(29)41)45-30-26(35)18-23(19-27(30)36)17-24(46)5-9-32(21-42)10-13-43-14-11-32/h6,12,18-20,42H,4-5,7-11,13-17,21-22H2,1-3H3 |
| InChIKey | OIJSHHLPLQOTAU-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|