C26H29F5N4O4Si — CID 142494824
(3E)-1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(oxan-3-ylidene)urea (PubChem CID 142494824) has the molecular formula C26H29F5N4O4Si and a molecular weight of 584.62 g/mol. Its IUPAC name is (3E)-1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(oxan-3-ylidene)urea.
| Compound Name | (3E)-1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(oxan-3-ylidene)urea |
|---|---|
| PubChem CID | 142494824 |
| Molecular Formula | C26H29F5N4O4Si |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | (3E)-1-[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(oxan-3-ylidene)urea |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)c2c(Oc3c(F)cc(NC(=O)/N=C4\CCCOC4)cc3F)ccnc21 |
| InChI | InChI=1S/C26H29F5N4O4Si/c1-40(2,3)10-9-38-15-35-13-18(26(29,30)31)22-21(6-7-32-24(22)35)39-23-19(27)11-17(12-20(23)28)34-25(36)33-16-5-4-8-37-14-16/h6-7,11-13H,4-5,8-10,14-15H2,1-3H3,(H,34,36)/b33-16+ |
| InChIKey | ZFPXQXNPBBEVPO-MHDJOFBISA-N |
| XLogP | 7.22 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|