C31H40F5N5O4SSi — CID 151396391
tert-butyl N-[[1-[[[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamothioylamino]methyl]cyclopropyl]methyl]carbamate (PubChem CID 151396391) has the molecular formula C31H40F5N5O4SSi and a molecular weight of 701.84 g/mol. Its IUPAC name is tert-butyl N-[[1-[[[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamothioylamino]methyl]cyclopropyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[[[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamothioylamino]methyl]cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 151396391 |
| Molecular Formula | C31H40F5N5O4SSi |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.25 |
| IUPAC Name | tert-butyl N-[[1-[[[3,5-difluoro-4-[3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]carbamothioylamino]methyl]cyclopropyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(CNC(=S)Nc2cc(F)c(Oc3ccnc4c3c(C(F)(F)F)cn4COCC[Si](C)(C)C)c(F)c2)CC1 |
| InChI | InChI=1S/C31H40F5N5O4SSi/c1-29(2,3)45-28(42)39-17-30(8-9-30)16-38-27(46)40-19-13-21(32)25(22(33)14-19)44-23-7-10-37-26-24(23)20(31(34,35)36)15-41(26)18-43-11-12-47(4,5)6/h7,10,13-15H,8-9,11-12,16-18H2,1-6H3,(H,39,42)(H2,38,40,46) |
| InChIKey | OVNYIBHUOKHQNP-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|