C27H33ClF2N4O4Si — CID 142518449
N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-2,9-dioxa-4-azaspiro[5.5]undec-3-en-3-amine (PubChem CID 142518449) has the molecular formula C27H33ClF2N4O4Si and a molecular weight of 579.12 g/mol. Its IUPAC name is N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-2,9-dioxa-4-azaspiro[5.5]undec-3-en-3-amine.
| Compound Name | N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-2,9-dioxa-4-azaspiro[5.5]undec-3-en-3-amine |
|---|---|
| PubChem CID | 142518449 |
| Molecular Formula | C27H33ClF2N4O4Si |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | N-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-2,9-dioxa-4-azaspiro[5.5]undec-3-en-3-amine |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(Oc3c(F)cc(NC4=NCC5(CCOCC5)CO4)cc3F)ccnc21 |
| InChI | InChI=1S/C27H33ClF2N4O4Si/c1-39(2,3)11-10-36-17-34-14-19(28)23-22(4-7-31-25(23)34)38-24-20(29)12-18(13-21(24)30)33-26-32-15-27(16-37-26)5-8-35-9-6-27/h4,7,12-14H,5-6,8-11,15-17H2,1-3H3,(H,32,33) |
| InChIKey | BXTXNSRROXLFJA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|