C28H34F2N6O5Si — CID 142518348
[2-[3,5-difluoro-4-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyanilino]-5-methyl-4,6-dihydro-1,3-oxazin-5-yl]methanol (PubChem CID 142518348) has the molecular formula C28H34F2N6O5Si and a molecular weight of 600.70 g/mol. Its IUPAC name is [2-[3,5-difluoro-4-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyanilino]-5-methyl-4,6-dihydro-1,3-oxazin-5-yl]methanol.
| Compound Name | [2-[3,5-difluoro-4-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyanilino]-5-methyl-4,6-dihydro-1,3-oxazin-5-yl]methanol |
|---|---|
| PubChem CID | 142518348 |
| Molecular Formula | C28H34F2N6O5Si |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | [2-[3,5-difluoro-4-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyanilino]-5-methyl-4,6-dihydro-1,3-oxazin-5-yl]methanol |
| SMILES | Cc1nnc(-c2cn(COCC[Si](C)(C)C)c3nccc(Oc4c(F)cc(NC5=NCC(C)(CO)CO5)cc4F)c23)o1 |
| InChI | InChI=1S/C28H34F2N6O5Si/c1-17-34-35-26(40-17)19-12-36(16-38-8-9-42(3,4)5)25-23(19)22(6-7-31-25)41-24-20(29)10-18(11-21(24)30)33-27-32-13-28(2,14-37)15-39-27/h6-7,10-12,37H,8-9,13-16H2,1-5H3,(H,32,33) |
| InChIKey | DPMZZJILNICPAJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|