C34H40F3N5O4SSi — CID 142518584
1-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea (PubChem CID 142518584) has the molecular formula C34H40F3N5O4SSi and a molecular weight of 699.87 g/mol. Its IUPAC name is 1-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea.
| Compound Name | 1-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 142518584 |
| Molecular Formula | C34H40F3N5O4SSi |
| Molecular Weight | 699.87 g/mol |
| Exact Mass | 699.25 |
| IUPAC Name | 1-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)thiourea |
| SMILES | CC(C)Oc1ccc(-c2cn(COCC[Si](C)(C)C)c3nccc(Oc4ccc(NC(=S)NCCCO)cc4C(F)(F)F)c23)cc1C#N |
| InChI | InChI=1S/C34H40F3N5O4SSi/c1-22(2)45-28-9-7-23(17-24(28)19-38)26-20-42(21-44-15-16-48(3,4)5)32-31(26)30(11-13-39-32)46-29-10-8-25(18-27(29)34(35,36)37)41-33(47)40-12-6-14-43/h7-11,13,17-18,20,22,43H,6,12,14-16,21H2,1-5H3,(H2,40,41,47) |
| InChIKey | JRTRIBQANBQUDY-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.87 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|