C37H37F3N4O4SSi — CID 142518515
O-phenyl N-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]carbamothioate (PubChem CID 142518515) has the molecular formula C37H37F3N4O4SSi and a molecular weight of 718.87 g/mol. Its IUPAC name is O-phenyl N-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]carbamothioate.
| Compound Name | O-phenyl N-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]carbamothioate |
|---|---|
| PubChem CID | 142518515 |
| Molecular Formula | C37H37F3N4O4SSi |
| Molecular Weight | 718.87 g/mol |
| Exact Mass | 718.23 |
| IUPAC Name | O-phenyl N-[4-[3-(3-cyano-4-propan-2-yloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3-(trifluoromethyl)phenyl]carbamothioate |
| SMILES | CC(C)Oc1ccc(-c2cn(COCC[Si](C)(C)C)c3nccc(Oc4ccc(NC(=S)Oc5ccccc5)cc4C(F)(F)F)c23)cc1C#N |
| InChI | InChI=1S/C37H37F3N4O4SSi/c1-24(2)46-31-13-11-25(19-26(31)21-41)29-22-44(23-45-17-18-50(3,4)5)35-34(29)33(15-16-42-35)48-32-14-12-27(20-30(32)37(38,39)40)43-36(49)47-28-9-7-6-8-10-28/h6-16,19-20,22,24H,17-18,23H2,1-5H3,(H,43,49) |
| InChIKey | WBLLXEOVSDAAQS-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.87 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|