C15H23ClN2OSi — CID 67502225
2-[(4-chloro-3-ethylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 67502225) has the molecular formula C15H23ClN2OSi and a molecular weight of 310.90 g/mol. Its IUPAC name is 2-[(4-chloro-3-ethylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-chloro-3-ethylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67502225 |
| Molecular Formula | C15H23ClN2OSi |
| Molecular Weight | 310.90 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[(4-chloro-3-ethylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | CCc1cn(COCC[Si](C)(C)C)c2nccc(Cl)c12 |
| InChI | InChI=1S/C15H23ClN2OSi/c1-5-12-10-18(11-19-8-9-20(2,3)4)15-14(12)13(16)6-7-17-15/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | XPPKGIUWEGUHNX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|