C25H25Cl2N3O3Si — CID 170669742
(2-chloro-4-pyridin-3-yloxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 170669742) has the molecular formula C25H25Cl2N3O3Si and a molecular weight of 514.49 g/mol. Its IUPAC name is (2-chloro-4-pyridin-3-yloxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (2-chloro-4-pyridin-3-yloxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 170669742 |
| Molecular Formula | C25H25Cl2N3O3Si |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | (2-chloro-4-pyridin-3-yloxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)c2ccc(Oc3cccnc3)cc2Cl)c2c(Cl)ccnc21 |
| InChI | InChI=1S/C25H25Cl2N3O3Si/c1-34(2,3)12-11-32-16-30-15-20(23-21(26)8-10-29-25(23)30)24(31)19-7-6-17(13-22(19)27)33-18-5-4-9-28-14-18/h4-10,13-15H,11-12,16H2,1-3H3 |
| InChIKey | IRRCSUFPLJXEIS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|