C22H32N6O2Si — CID 144576928
3-tert-butyl-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 144576928) has the molecular formula C22H32N6O2Si and a molecular weight of 440.62 g/mol. Its IUPAC name is 3-tert-butyl-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 3-tert-butyl-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 144576928 |
| Molecular Formula | C22H32N6O2Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-tert-butyl-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)c1nc2c(nc1Nc1cccnc1)c(C(N)=O)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H32N6O2Si/c1-22(2,3)18-20(25-15-8-7-9-24-12-15)26-17-16(19(23)29)13-28(21(17)27-18)14-30-10-11-31(4,5)6/h7-9,12-13H,10-11,14H2,1-6H3,(H2,23,29)(H,25,26) |
| InChIKey | JBGVVTCZJWHPNC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|