C28H36F2N6O4Si — CID 89421616
3-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxopropyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 89421616) has the molecular formula C28H36F2N6O4Si and a molecular weight of 586.72 g/mol. Its IUPAC name is 3-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxopropyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 3-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxopropyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 89421616 |
| Molecular Formula | C28H36F2N6O4Si |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 3-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxopropyl)indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)c1nc2c(nc1-c1nn(CCC=O)c3ccc(OC(F)F)cc13)c(C(N)=O)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H36F2N6O4Si/c1-28(2,3)24-23(21-18-14-17(40-27(29)30)8-9-20(18)36(34-21)10-7-11-37)32-22-19(25(31)38)15-35(26(22)33-24)16-39-12-13-41(4,5)6/h8-9,11,14-15,27H,7,10,12-13,16H2,1-6H3,(H2,31,38) |
| InChIKey | HITKTYLEDIIBMG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|