C23H34N6O4SSi — CID 90041606
3-tert-butyl-2-[(5-methylsulfonyl-3-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 90041606) has the molecular formula C23H34N6O4SSi and a molecular weight of 518.72 g/mol. Its IUPAC name is 3-tert-butyl-2-[(5-methylsulfonyl-3-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 3-tert-butyl-2-[(5-methylsulfonyl-3-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 90041606 |
| Molecular Formula | C23H34N6O4SSi |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 3-tert-butyl-2-[(5-methylsulfonyl-3-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)c1nc2c(nc1Nc1cncc(S(C)(=O)=O)c1)c(C(N)=O)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H34N6O4SSi/c1-23(2,3)19-21(26-15-10-16(12-25-11-15)34(4,31)32)27-18-17(20(24)30)13-29(22(18)28-19)14-33-8-9-35(5,6)7/h10-13H,8-9,14H2,1-7H3,(H2,24,30)(H,26,27) |
| InChIKey | ZACNTLWJRQECSV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|