C23H38N4O4SSi — CID 67008786
2-cyclopropyl-N-[(2S)-3,3-dimethyl-4-methylsulfonylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 67008786) has the molecular formula C23H38N4O4SSi and a molecular weight of 494.73 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(2S)-3,3-dimethyl-4-methylsulfonylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-cyclopropyl-N-[(2S)-3,3-dimethyl-4-methylsulfonylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 67008786 |
| Molecular Formula | C23H38N4O4SSi |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-cyclopropyl-N-[(2S)-3,3-dimethyl-4-methylsulfonylbutan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(C3CC3)nc12)C(C)(C)CS(C)(=O)=O |
| InChI | InChI=1S/C23H38N4O4SSi/c1-16(23(2,3)14-32(4,29)30)25-22(28)18-13-27(15-31-10-11-33(5,6)7)21-20(18)26-19(12-24-21)17-8-9-17/h12-13,16-17H,8-11,14-15H2,1-7H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | MJHSTUYMCBOOJH-INIZCTEOSA-N |
| XLogP | 3.81 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|