C14H20BrN3O2Si — CID 88906942
1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]ethenol (PubChem CID 88906942) has the molecular formula C14H20BrN3O2Si and a molecular weight of 370.32 g/mol. Its IUPAC name is 1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]ethenol.
| Compound Name | 1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]ethenol |
|---|---|
| PubChem CID | 88906942 |
| Molecular Formula | C14H20BrN3O2Si |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]ethenol |
| SMILES | C=C(O)c1cn(COCC[Si](C)(C)C)c2ncc(Br)nc12 |
| InChI | InChI=1S/C14H20BrN3O2Si/c1-10(19)11-8-18(9-20-5-6-21(2,3)4)14-13(11)17-12(15)7-16-14/h7-8,19H,1,5-6,9H2,2-4H3 |
| InChIKey | QULHXLDDEFRORB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|