C19H28N2O4Si — CID 58395961
(Z)-4-[4-ethoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-4-hydroxybut-3-en-2-one (PubChem CID 58395961) has the molecular formula C19H28N2O4Si and a molecular weight of 376.53 g/mol. Its IUPAC name is (Z)-4-[4-ethoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-4-hydroxybut-3-en-2-one.
| Compound Name | (Z)-4-[4-ethoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 58395961 |
| Molecular Formula | C19H28N2O4Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (Z)-4-[4-ethoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-4-hydroxybut-3-en-2-one |
| SMILES | CCOc1ccnc2c1c(/C(O)=C/C(C)=O)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H28N2O4Si/c1-6-25-17-7-8-20-19-18(17)15(16(23)11-14(2)22)12-21(19)13-24-9-10-26(3,4)5/h7-8,11-12,23H,6,9-10,13H2,1-5H3/b16-11- |
| InChIKey | PPCUODHQXDXKHF-WJDWOHSUSA-N |
| XLogP | 4.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|