C26H26Cl2N2O3Si — CID 170669754
(3-chloro-4-phenoxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 170669754) has the molecular formula C26H26Cl2N2O3Si and a molecular weight of 513.50 g/mol. Its IUPAC name is (3-chloro-4-phenoxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-chloro-4-phenoxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 170669754 |
| Molecular Formula | C26H26Cl2N2O3Si |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | (3-chloro-4-phenoxyphenyl)-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)c2ccc(Oc3ccccc3)c(Cl)c2)c2c(Cl)ccnc21 |
| InChI | InChI=1S/C26H26Cl2N2O3Si/c1-34(2,3)14-13-32-17-30-16-20(24-21(27)11-12-29-26(24)30)25(31)18-9-10-23(22(28)15-18)33-19-7-5-4-6-8-19/h4-12,15-16H,13-14,17H2,1-3H3 |
| InChIKey | RIGAVEVUPQDMFD-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|