C35H50ClN3O3Si2 — CID 175998129
N-(3-chloro-4-methoxyphenyl)-N-[phenyl-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-3-tri(propan-2-yl)silylprop-2-ynamide (PubChem CID 175998129) has the molecular formula C35H50ClN3O3Si2 and a molecular weight of 652.43 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N-[phenyl-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-3-tri(propan-2-yl)silylprop-2-ynamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N-[phenyl-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-3-tri(propan-2-yl)silylprop-2-ynamide |
|---|---|
| PubChem CID | 175998129 |
| Molecular Formula | C35H50ClN3O3Si2 |
| Molecular Weight | 652.43 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N-[phenyl-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-3-tri(propan-2-yl)silylprop-2-ynamide |
| SMILES | COc1ccc(N(C(=O)C#C[Si](C(C)C)(C(C)C)C(C)C)C(c2ccccc2)c2nccn2COCC[Si](C)(C)C)cc1Cl |
| InChI | InChI=1S/C35H50ClN3O3Si2/c1-26(2)44(27(3)4,28(5)6)22-18-33(40)39(30-16-17-32(41-7)31(36)24-30)34(29-14-12-11-13-15-29)35-37-19-20-38(35)25-42-21-23-43(8,9)10/h11-17,19-20,24,26-28,34H,21,23,25H2,1-10H3 |
| InChIKey | XOYWZWKVRVSBFM-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.43 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|